C19H20F3N5O3 — CID 55994958
[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 55994958) has the molecular formula C19H20F3N5O3 and a molecular weight of 423.40 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 55994958 |
| Molecular Formula | C19H20F3N5O3 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cnc3ncnn3c2C(C)C)c(C)n1CC(F)(F)F |
| InChI | InChI=1S/C19H20F3N5O3/c1-10(2)16-14(6-23-18-24-9-25-27(16)18)17(29)30-7-15(28)13-5-11(3)26(12(13)4)8-19(20,21)22/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | DOSDHHYXPVQTPY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |