C17H19N5O2S2 — CID 55996511
2-(4-ethoxy-3-methoxyphenyl)-4-[(1-prop-2-enyltetrazol-5-yl)sulfanylmethyl]-1,3-thiazole (PubChem CID 55996511) has the molecular formula C17H19N5O2S2 and a molecular weight of 389.51 g/mol. Its IUPAC name is 2-(4-ethoxy-3-methoxyphenyl)-4-[(1-prop-2-enyltetrazol-5-yl)sulfanylmethyl]-1,3-thiazole.
| Compound Name | 2-(4-ethoxy-3-methoxyphenyl)-4-[(1-prop-2-enyltetrazol-5-yl)sulfanylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 55996511 |
| Molecular Formula | C17H19N5O2S2 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-(4-ethoxy-3-methoxyphenyl)-4-[(1-prop-2-enyltetrazol-5-yl)sulfanylmethyl]-1,3-thiazole |
| SMILES | C=CCn1nnnc1SCc1csc(-c2ccc(OCC)c(OC)c2)n1 |
| InChI | InChI=1S/C17H19N5O2S2/c1-4-8-22-17(19-20-21-22)26-11-13-10-25-16(18-13)12-6-7-14(24-5-2)15(9-12)23-3/h4,6-7,9-10H,1,5,8,11H2,2-3H3 |
| InChIKey | RNDCFMPHYYLZBF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|