C16H19N5O3S2 — CID 55996768
1-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylethanone (PubChem CID 55996768) has the molecular formula C16H19N5O3S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylethanone.
| Compound Name | 1-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylethanone |
|---|---|
| PubChem CID | 55996768 |
| Molecular Formula | C16H19N5O3S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 1-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylethanone |
| SMILES | C=CCn1nnnc1SCC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O |
| InChI | InChI=1S/C16H19N5O3S2/c1-3-8-20-16(17-18-19-20)25-11-15(22)13-6-7-14-12(10-13)5-4-9-21(14)26(2,23)24/h3,6-7,10H,1,4-5,8-9,11H2,2H3 |
| InChIKey | BVDCOQLZQFCCKW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|