C17H20F3N3O2S — CID 55997009
3-(2-methoxyphenyl)-4-prop-2-enyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazole (PubChem CID 55997009) has the molecular formula C17H20F3N3O2S and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-4-prop-2-enyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-(2-methoxyphenyl)-4-prop-2-enyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 55997009 |
| Molecular Formula | C17H20F3N3O2S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-(2-methoxyphenyl)-4-prop-2-enyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazole |
| SMILES | C=CCn1c(SCCCOCC(F)(F)F)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C17H20F3N3O2S/c1-3-9-23-15(13-7-4-5-8-14(13)24-2)21-22-16(23)26-11-6-10-25-12-17(18,19)20/h3-5,7-8H,1,6,9-12H2,2H3 |
| InChIKey | ODKWKECHGNWNPO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|