C19H13ClF2N2O3 — CID 55998901
[1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-chloroquinoline-6-carboxylate (PubChem CID 55998901) has the molecular formula C19H13ClF2N2O3 and a molecular weight of 390.77 g/mol. Its IUPAC name is [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55998901 |
| Molecular Formula | C19H13ClF2N2O3 |
| Molecular Weight | 390.77 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-chloroquinoline-6-carboxylate |
| SMILES | CC(OC(=O)c1ccc2nc(Cl)ccc2c1)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C19H13ClF2N2O3/c1-10(18(25)24-16-9-13(21)4-5-14(16)22)27-19(26)12-2-6-15-11(8-12)3-7-17(20)23-15/h2-10H,1H3,(H,24,25) |
| InChIKey | MQBYZMMSEBUBGX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.77 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|