C23H21ClN2O4 — CID 55998902
[1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-chloroquinoline-6-carboxylate (PubChem CID 55998902) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is [1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55998902 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-chloroquinoline-6-carboxylate |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)C(C)OC(=O)c2ccc3nc(Cl)ccc3c2)cc1 |
| InChI | InChI=1S/C23H21ClN2O4/c1-13(2)22(28)25-18-8-4-15(5-9-18)21(27)14(3)30-23(29)17-6-10-19-16(12-17)7-11-20(24)26-19/h4-14H,1-3H3,(H,25,28) |
| InChIKey | AOPCNIHHKDNEGS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|