C8H12BrCl3O2 — CID 560506
ethyl 4-bromo-6,6,6-trichlorohexanoate (PubChem CID 560506) has the molecular formula C8H12BrCl3O2 and a molecular weight of 326.45 g/mol. Its IUPAC name is ethyl 4-bromo-6,6,6-trichlorohexanoate.
| Compound Name | ethyl 4-bromo-6,6,6-trichlorohexanoate |
|---|---|
| PubChem CID | 560506 |
| Molecular Formula | C8H12BrCl3O2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 323.91 |
| IUPAC Name | ethyl 4-bromo-6,6,6-trichlorohexanoate |
| SMILES | CCOC(=O)CCC(Br)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12BrCl3O2/c1-2-14-7(13)4-3-6(9)5-8(10,11)12/h6H,2-5H2,1H3 |
| InChIKey | RAXVOLKTAWCJQD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|