C17H24N2O3 — CID 562125
2-(benzylamino)-4-(cyclohexylamino)-4-oxobutanoic acid (PubChem CID 562125) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(benzylamino)-4-(cyclohexylamino)-4-oxobutanoic acid.
| Compound Name | 2-(benzylamino)-4-(cyclohexylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 562125 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(benzylamino)-4-(cyclohexylamino)-4-oxobutanoic acid |
| SMILES | O=C(CC(NCc1ccccc1)C(=O)O)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N2O3/c20-16(19-14-9-5-2-6-10-14)11-15(17(21)22)18-12-13-7-3-1-4-8-13/h1,3-4,7-8,14-15,18H,2,5-6,9-12H2,(H,19,20)(H,21,22) |
| InChIKey | VCCYANQOUCPGQP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |