C19H29NO3 — CID 563060
1-benzyl-5-(5,5-dimethoxyhexyl)pyrrolidin-2-one (PubChem CID 563060) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 1-benzyl-5-(5,5-dimethoxyhexyl)pyrrolidin-2-one.
| Compound Name | 1-benzyl-5-(5,5-dimethoxyhexyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 563060 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 1-benzyl-5-(5,5-dimethoxyhexyl)pyrrolidin-2-one |
| SMILES | COC(C)(CCCCC1CCC(=O)N1Cc1ccccc1)OC |
| InChI | InChI=1S/C19H29NO3/c1-19(22-2,23-3)14-8-7-11-17-12-13-18(21)20(17)15-16-9-5-4-6-10-16/h4-6,9-10,17H,7-8,11-15H2,1-3H3 |
| InChIKey | XGURHEBLBVGKAK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|