C27H32N2O2 — CID 563906
ethyl 3-amino-4-(dibenzylamino)-5-phenylpentanoate (PubChem CID 563906) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is ethyl 3-amino-4-(dibenzylamino)-5-phenylpentanoate.
| Compound Name | ethyl 3-amino-4-(dibenzylamino)-5-phenylpentanoate |
|---|---|
| PubChem CID | 563906 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | ethyl 3-amino-4-(dibenzylamino)-5-phenylpentanoate |
| SMILES | CCOC(=O)CC(N)C(Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H32N2O2/c1-2-31-27(30)19-25(28)26(18-22-12-6-3-7-13-22)29(20-23-14-8-4-9-15-23)21-24-16-10-5-11-17-24/h3-17,25-26H,2,18-21,28H2,1H3 |
| InChIKey | DTUOZZTYNDLQMR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |