About 1-propylsulfinylbutane
1-propylsulfinylbutane (PubChem CID 564183) has the molecular formula C7H16OS
and a molecular weight of 148.27 g/mol. Its IUPAC name is 1-propylsulfinylbutane.
Molecular Properties
| Compound Name | 1-propylsulfinylbutane |
| PubChem CID | 564183 |
| Molecular Formula | C7H16OS |
| Molecular Weight | 148.27 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 1-propylsulfinylbutane |
| SMILES | CCCCS(=O)CCC |
| InChI | InChI=1S/C7H16OS/c1-3-5-7-9(8)6-4-2/h3-7H2,1-2H3 |
| InChIKey | UXEUPWBGAVVPSF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propylsulfinylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylsulfinylbutane?
The IUPAC name of 1-propylsulfinylbutane (CID 564183) is 1-propylsulfinylbutane.
What is the SMILES notation for 1-propylsulfinylbutane?
The canonical SMILES for 1-propylsulfinylbutane is CCCCS(=O)CCC.
What is the InChIKey of 1-propylsulfinylbutane?
The InChIKey is UXEUPWBGAVVPSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16OS/c1-3-5-7-9(8)6-4-2/h3-7H2,1-2H3.
What are the key properties of 1-propylsulfinylbutane?
1-propylsulfinylbutane has a molecular weight of 148.27 g/mol, XLogP of 1.95, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylsulfinylbutane is sourced from PubChem (CID 564183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).