C16H22F3N3O3S — CID 56500520
N-[3-(4-methylpiperidin-1-yl)propyl]-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide (PubChem CID 56500520) has the molecular formula C16H22F3N3O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is N-[3-(4-methylpiperidin-1-yl)propyl]-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide.
| Compound Name | N-[3-(4-methylpiperidin-1-yl)propyl]-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56500520 |
| Molecular Formula | C16H22F3N3O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[3-(4-methylpiperidin-1-yl)propyl]-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide |
| SMILES | CC1CCN(CCCNC(=O)c2cccnc2S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F3N3O3S/c1-12-5-10-22(11-6-12)9-3-8-20-14(23)13-4-2-7-21-15(13)26(24,25)16(17,18)19/h2,4,7,12H,3,5-6,8-11H2,1H3,(H,20,23) |
| InChIKey | CFWGYSQOCILZJT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|