C15H17F3N2O3S — CID 71881401
N-[2-(cyclohexen-1-yl)ethyl]-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide (PubChem CID 71881401) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71881401 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cccnc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O3S/c16-15(17,18)24(22,23)14-12(7-4-9-20-14)13(21)19-10-8-11-5-2-1-3-6-11/h4-5,7,9H,1-3,6,8,10H2,(H,19,21) |
| InChIKey | MUPTXCHSXCOAIY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|