C24H29N3O2S — CID 5151631
N-[2-(cyclohexen-1-yl)ethyl]-2-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanylpyridine-3-carboxamide (PubChem CID 5151631) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanylpyridine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 5151631 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanylpyridine-3-carboxamide |
| SMILES | O=C(CSc1ncccc1C(=O)NCCC1=CCCCC1)NCCc1ccccc1 |
| InChI | InChI=1S/C24H29N3O2S/c28-22(25-16-13-19-8-3-1-4-9-19)18-30-24-21(12-7-15-27-24)23(29)26-17-14-20-10-5-2-6-11-20/h1,3-4,7-10,12,15H,2,5-6,11,13-14,16-18H2,(H,25,28)(H,26,29) |
| InChIKey | ZJOAEJOHYHQEBS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|