C21H25N3OS2 — CID 46392397
N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]sulfanylacetamide (PubChem CID 46392397) has the molecular formula C21H25N3OS2 and a molecular weight of 399.59 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]sulfanylacetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46392397 |
| Molecular Formula | C21H25N3OS2 |
| Molecular Weight | 399.59 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]sulfanylacetamide |
| SMILES | Cc1ccc(Sc2nccnc2SCC(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C21H25N3OS2/c1-16-7-9-18(10-8-16)27-21-20(23-13-14-24-21)26-15-19(25)22-12-11-17-5-3-2-4-6-17/h5,7-10,13-14H,2-4,6,11-12,15H2,1H3,(H,22,25) |
| InChIKey | XGMPQUMYSUUUCP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|