C22H24FNO3S — CID 56502454
N-[1-(4-fluorophenyl)cyclopentyl]-4,7-dioxo-7-thiophen-2-ylheptanamide (PubChem CID 56502454) has the molecular formula C22H24FNO3S and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)cyclopentyl]-4,7-dioxo-7-thiophen-2-ylheptanamide.
| Compound Name | N-[1-(4-fluorophenyl)cyclopentyl]-4,7-dioxo-7-thiophen-2-ylheptanamide |
|---|---|
| PubChem CID | 56502454 |
| Molecular Formula | C22H24FNO3S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[1-(4-fluorophenyl)cyclopentyl]-4,7-dioxo-7-thiophen-2-ylheptanamide |
| SMILES | O=C(CCC(=O)NC1(c2ccc(F)cc2)CCCC1)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C22H24FNO3S/c23-17-7-5-16(6-8-17)22(13-1-2-14-22)24-21(27)12-10-18(25)9-11-19(26)20-4-3-15-28-20/h3-8,15H,1-2,9-14H2,(H,24,27) |
| InChIKey | BQMQJBFFPMITJH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |