C21H31F3N4O3 — CID 56505477
1-benzyl-1-methyl-3-[3-oxo-3-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propyl]urea (PubChem CID 56505477) has the molecular formula C21H31F3N4O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is 1-benzyl-1-methyl-3-[3-oxo-3-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propyl]urea.
| Compound Name | 1-benzyl-1-methyl-3-[3-oxo-3-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 56505477 |
| Molecular Formula | C21H31F3N4O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 1-benzyl-1-methyl-3-[3-oxo-3-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propyl]urea |
| SMILES | CN(Cc1ccccc1)C(=O)NCCC(=O)N1CCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C21H31F3N4O3/c1-26(16-18-6-3-2-4-7-18)20(30)25-9-8-19(29)28-13-11-27(12-14-28)10-5-15-31-17-21(22,23)24/h2-4,6-7H,5,8-17H2,1H3,(H,25,30) |
| InChIKey | NONJOWZKRYGNLN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|