C19H16F3NO3 — CID 56507494
(Z)-N-[1-(1,3-benzodioxol-5-yl)ethyl]-4,4,4-trifluoro-3-phenylbut-2-enamide (PubChem CID 56507494) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is (Z)-N-[1-(1,3-benzodioxol-5-yl)ethyl]-4,4,4-trifluoro-3-phenylbut-2-enamide.
| Compound Name | (Z)-N-[1-(1,3-benzodioxol-5-yl)ethyl]-4,4,4-trifluoro-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 56507494 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (Z)-N-[1-(1,3-benzodioxol-5-yl)ethyl]-4,4,4-trifluoro-3-phenylbut-2-enamide |
| SMILES | CC(NC(=O)/C=C(/c1ccccc1)C(F)(F)F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16F3NO3/c1-12(14-7-8-16-17(9-14)26-11-25-16)23-18(24)10-15(19(20,21)22)13-5-3-2-4-6-13/h2-10,12H,11H2,1H3,(H,23,24)/b15-10- |
| InChIKey | VFBMRRWHZHAZCP-GDNBJRDFSA-N |
| XLogP | 4.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|