C23H16F2N2O5 — CID 56508226
4-(difluoromethoxy)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-methoxybenzamide (PubChem CID 56508226) has the molecular formula C23H16F2N2O5 and a molecular weight of 438.39 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 56508226 |
| Molecular Formula | C23H16F2N2O5 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 4-(difluoromethoxy)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cccc(N3C(=O)c4ccccc4C3=O)c2)ccc1OC(F)F |
| InChI | InChI=1S/C23H16F2N2O5/c1-31-19-11-13(9-10-18(19)32-23(24)25)20(28)26-14-5-4-6-15(12-14)27-21(29)16-7-2-3-8-17(16)22(27)30/h2-12,23H,1H3,(H,26,28) |
| InChIKey | XADPVUAQVIUYCS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|