C22H20F3N3O2 — CID 56508380
(Z)-4,4,4-trifluoro-N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-phenylbut-2-enamide (PubChem CID 56508380) has the molecular formula C22H20F3N3O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-phenylbut-2-enamide.
| Compound Name | (Z)-4,4,4-trifluoro-N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 56508380 |
| Molecular Formula | C22H20F3N3O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (Z)-4,4,4-trifluoro-N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-phenylbut-2-enamide |
| SMILES | COc1ccc(C(NC(=O)/C=C(/c2ccccc2)C(F)(F)F)c2nccn2C)cc1 |
| InChI | InChI=1S/C22H20F3N3O2/c1-28-13-12-26-21(28)20(16-8-10-17(30-2)11-9-16)27-19(29)14-18(22(23,24)25)15-6-4-3-5-7-15/h3-14,20H,1-2H3,(H,27,29)/b18-14- |
| InChIKey | JYRTYJLDYMAMCS-JXAWBTAJSA-N |
| XLogP | 4.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|