C23H16N2O5 — CID 56508469
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 56508469) has the molecular formula C23H16N2O5 and a molecular weight of 400.39 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 56508469 |
| Molecular Formula | C23H16N2O5 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(Nc1cccc(N2C(=O)c3ccccc3C2=O)c1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C23H16N2O5/c26-21(20-13-29-18-10-3-4-11-19(18)30-20)24-14-6-5-7-15(12-14)25-22(27)16-8-1-2-9-17(16)23(25)28/h1-12,20H,13H2,(H,24,26) |
| InChIKey | BQGFAPOMVDLKHH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|