C20H21NO4 — CID 42949307
N-(3-cyclopentyloxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 42949307) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-(3-cyclopentyloxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-(3-cyclopentyloxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 42949307 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-(3-cyclopentyloxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(Nc1cccc(OC2CCCC2)c1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C20H21NO4/c22-20(19-13-23-17-10-3-4-11-18(17)25-19)21-14-6-5-9-16(12-14)24-15-7-1-2-8-15/h3-6,9-12,15,19H,1-2,7-8,13H2,(H,21,22) |
| InChIKey | DOSSIXSXEVMXEM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |