C24H17N3O4S — CID 56509196
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide (PubChem CID 56509196) has the molecular formula C24H17N3O4S and a molecular weight of 443.48 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 56509196 |
| Molecular Formula | C24H17N3O4S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide |
| SMILES | O=C1CCSc2ccc(C(=O)Nc3cccc(N4C(=O)c5ccccc5C4=O)c3)cc2N1 |
| InChI | InChI=1S/C24H17N3O4S/c28-21-10-11-32-20-9-8-14(12-19(20)26-21)22(29)25-15-4-3-5-16(13-15)27-23(30)17-6-1-2-7-18(17)24(27)31/h1-9,12-13H,10-11H2,(H,25,29)(H,26,28) |
| InChIKey | DYEPLMUHUZZVRX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|