C19H31N3O — CID 56509530
2-[ethyl(methyl)amino]-1-[4-(2-methylpropyl)piperazin-1-yl]-2-phenylethanone (PubChem CID 56509530) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-[ethyl(methyl)amino]-1-[4-(2-methylpropyl)piperazin-1-yl]-2-phenylethanone.
| Compound Name | 2-[ethyl(methyl)amino]-1-[4-(2-methylpropyl)piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 56509530 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 2-[ethyl(methyl)amino]-1-[4-(2-methylpropyl)piperazin-1-yl]-2-phenylethanone |
| SMILES | CCN(C)C(C(=O)N1CCN(CC(C)C)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H31N3O/c1-5-20(4)18(17-9-7-6-8-10-17)19(23)22-13-11-21(12-14-22)15-16(2)3/h6-10,16,18H,5,11-15H2,1-4H3 |
| InChIKey | AVVXKRQNTDXGLO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |