C18H27N3O2 — CID 8913700
2-[methyl-[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-N-propan-2-ylacetamide (PubChem CID 8913700) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-[methyl-[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[methyl-[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 8913700 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-[methyl-[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN(C)[C@H](C(=O)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H27N3O2/c1-14(2)19-16(22)13-20(3)17(15-9-5-4-6-10-15)18(23)21-11-7-8-12-21/h4-6,9-10,14,17H,7-8,11-13H2,1-3H3,(H,19,22)/t17-/m0/s1 |
| InChIKey | ZFQFONKFOCHNJV-KRWDZBQOSA-N |
| XLogP | 1.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |