C15H22N4O2 — CID 63584319
2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]-2-phenylacetohydrazide (PubChem CID 63584319) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]-2-phenylacetohydrazide.
| Compound Name | 2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 63584319 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]-2-phenylacetohydrazide |
| SMILES | CN(CC(=O)N1CCCC1)C(C(=O)NN)c1ccccc1 |
| InChI | InChI=1S/C15H22N4O2/c1-18(11-13(20)19-9-5-6-10-19)14(15(21)17-16)12-7-3-2-4-8-12/h2-4,7-8,14H,5-6,9-11,16H2,1H3,(H,17,21) |
| InChIKey | MQMUFBQVCDQCIT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|