C21H29ClN4O3 — CID 56509907
1-[(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide (PubChem CID 56509907) has the molecular formula C21H29ClN4O3 and a molecular weight of 420.94 g/mol. Its IUPAC name is 1-[(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56509907 |
| Molecular Formula | C21H29ClN4O3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-[(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide |
| SMILES | CC(C)OCCCNC(=O)C1CCN(Cc2cc(=O)n3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C21H29ClN4O3/c1-15(2)29-11-3-8-23-21(28)16-6-9-25(10-7-16)14-18-12-20(27)26-13-17(22)4-5-19(26)24-18/h4-5,12-13,15-16H,3,6-11,14H2,1-2H3,(H,23,28) |
| InChIKey | OICJOYBJXQWBGH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|