C21H33ClN2O2S — CID 56510035
1-[3-(2-chlorophenyl)sulfanylpropyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide (PubChem CID 56510035) has the molecular formula C21H33ClN2O2S and a molecular weight of 413.03 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)sulfanylpropyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(2-chlorophenyl)sulfanylpropyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56510035 |
| Molecular Formula | C21H33ClN2O2S |
| Molecular Weight | 413.03 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[3-(2-chlorophenyl)sulfanylpropyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide |
| SMILES | CC(C)OCCCNC(=O)C1CCN(CCCSc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H33ClN2O2S/c1-17(2)26-15-5-11-23-21(25)18-9-13-24(14-10-18)12-6-16-27-20-8-4-3-7-19(20)22/h3-4,7-8,17-18H,5-6,9-16H2,1-2H3,(H,23,25) |
| InChIKey | UMWDDPAEHAQNNC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.03 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|