C20H31FN2O2 — CID 60503970
1-[1-(4-fluorophenyl)ethyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide (PubChem CID 60503970) has the molecular formula C20H31FN2O2 and a molecular weight of 350.48 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)ethyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(4-fluorophenyl)ethyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60503970 |
| Molecular Formula | C20H31FN2O2 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 1-[1-(4-fluorophenyl)ethyl]-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide |
| SMILES | CC(C)OCCCNC(=O)C1CCN(C(C)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H31FN2O2/c1-15(2)25-14-4-11-22-20(24)18-9-12-23(13-10-18)16(3)17-5-7-19(21)8-6-17/h5-8,15-16,18H,4,9-14H2,1-3H3,(H,22,24) |
| InChIKey | PWRPPFGDHSGGCB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|