C18H27BrN2O4S — CID 126235408
1-(4-bromophenyl)sulfonyl-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide (PubChem CID 126235408) has the molecular formula C18H27BrN2O4S and a molecular weight of 447.40 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126235408 |
| Molecular Formula | C18H27BrN2O4S |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-(3-propan-2-yloxypropyl)piperidine-4-carboxamide |
| SMILES | CC(C)OCCCNC(=O)C1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H27BrN2O4S/c1-14(2)25-13-3-10-20-18(22)15-8-11-21(12-9-15)26(23,24)17-6-4-16(19)5-7-17/h4-7,14-15H,3,8-13H2,1-2H3,(H,20,22) |
| InChIKey | LIIOKIAGOZEMIH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|