C24H37N3O5S — CID 3787269
1-[1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl]-N-(3-propan-2-yloxypropyl)pyrrolidine-2-carboxamide (PubChem CID 3787269) has the molecular formula C24H37N3O5S and a molecular weight of 479.64 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl]-N-(3-propan-2-yloxypropyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl]-N-(3-propan-2-yloxypropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3787269 |
| Molecular Formula | C24H37N3O5S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 1-[1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl]-N-(3-propan-2-yloxypropyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)N3CCCC3C(=O)NCCCOC(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H37N3O5S/c1-18(2)32-17-5-13-25-23(28)22-6-4-14-27(22)24(29)20-11-15-26(16-12-20)33(30,31)21-9-7-19(3)8-10-21/h7-10,18,20,22H,4-6,11-17H2,1-3H3,(H,25,28) |
| InChIKey | NSWZUWBKWLYQPL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|