C20H30N2O2 — CID 56510273
N,N-dicyclohexyl-2-(3-methyl-2-oxo-1-pyridinyl)acetamide (PubChem CID 56510273) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-(3-methyl-2-oxo-1-pyridinyl)acetamide.
| Compound Name | N,N-dicyclohexyl-2-(3-methyl-2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 56510273 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | N,N-dicyclohexyl-2-(3-methyl-2-oxo-1-pyridinyl)acetamide |
| SMILES | Cc1cccn(CC(=O)N(C2CCCCC2)C2CCCCC2)c1=O |
| InChI | InChI=1S/C20H30N2O2/c1-16-9-8-14-21(20(16)24)15-19(23)22(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h8-9,14,17-18H,2-7,10-13,15H2,1H3 |
| InChIKey | IWRSIGACVWKDQA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |