C20H23ClN4O3 — CID 56512821
2-(5-acetamido-2-chloroanilino)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide (PubChem CID 56512821) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-(5-acetamido-2-chloroanilino)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-(5-acetamido-2-chloroanilino)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 56512821 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-(5-acetamido-2-chloroanilino)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(NCC(=O)N(C)CC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H23ClN4O3/c1-13-4-6-15(7-5-13)24-19(27)12-25(3)20(28)11-22-18-10-16(23-14(2)26)8-9-17(18)21/h4-10,22H,11-12H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | CKRPFBYIRJOVMU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |