C24H30N2O4 — CID 56513208
ethyl 2-benzyl-3-[[3-(morpholin-4-ylmethyl)benzoyl]amino]propanoate (PubChem CID 56513208) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is ethyl 2-benzyl-3-[[3-(morpholin-4-ylmethyl)benzoyl]amino]propanoate.
| Compound Name | ethyl 2-benzyl-3-[[3-(morpholin-4-ylmethyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 56513208 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | ethyl 2-benzyl-3-[[3-(morpholin-4-ylmethyl)benzoyl]amino]propanoate |
| SMILES | CCOC(=O)C(CNC(=O)c1cccc(CN2CCOCC2)c1)Cc1ccccc1 |
| InChI | InChI=1S/C24H30N2O4/c1-2-30-24(28)22(15-19-7-4-3-5-8-19)17-25-23(27)21-10-6-9-20(16-21)18-26-11-13-29-14-12-26/h3-10,16,22H,2,11-15,17-18H2,1H3,(H,25,27) |
| InChIKey | NHEGMOPLOHQZOG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |