C25H34N2O2 — CID 56513235
2-[benzhydryl(3-hydroxypropyl)amino]-N-(2-methylcyclohexyl)acetamide (PubChem CID 56513235) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-[benzhydryl(3-hydroxypropyl)amino]-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-[benzhydryl(3-hydroxypropyl)amino]-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 56513235 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 2-[benzhydryl(3-hydroxypropyl)amino]-N-(2-methylcyclohexyl)acetamide |
| SMILES | CC1CCCCC1NC(=O)CN(CCCO)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34N2O2/c1-20-11-8-9-16-23(20)26-24(29)19-27(17-10-18-28)25(21-12-4-2-5-13-21)22-14-6-3-7-15-22/h2-7,12-15,20,23,25,28H,8-11,16-19H2,1H3,(H,26,29) |
| InChIKey | XHWSNPGXAQYKDN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |