C22H26N4O5S — CID 56513539
N,N-dimethyl-3-[[[2-(2-oxopiperidin-1-yl)-2-phenylacetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 56513539) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is N,N-dimethyl-3-[[[2-(2-oxopiperidin-1-yl)-2-phenylacetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[[2-(2-oxopiperidin-1-yl)-2-phenylacetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56513539 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N,N-dimethyl-3-[[[2-(2-oxopiperidin-1-yl)-2-phenylacetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NNC(=O)C(c2ccccc2)N2CCCCC2=O)c1 |
| InChI | InChI=1S/C22H26N4O5S/c1-25(2)32(30,31)18-12-8-11-17(15-18)21(28)23-24-22(29)20(16-9-4-3-5-10-16)26-14-7-6-13-19(26)27/h3-5,8-12,15,20H,6-7,13-14H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | SIPJESGEEHCSNR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|