C27H30N2O4 — CID 56513630
methyl 3-[[2-[benzhydryl(3-hydroxypropyl)amino]acetyl]amino]-4-methylbenzoate (PubChem CID 56513630) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is methyl 3-[[2-[benzhydryl(3-hydroxypropyl)amino]acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[benzhydryl(3-hydroxypropyl)amino]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 56513630 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | methyl 3-[[2-[benzhydryl(3-hydroxypropyl)amino]acetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)CN(CCCO)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H30N2O4/c1-20-14-15-23(27(32)33-2)18-24(20)28-25(31)19-29(16-9-17-30)26(21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-8,10-15,18,26,30H,9,16-17,19H2,1-2H3,(H,28,31) |
| InChIKey | FDSWUKDKRLABKH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |