C20H36N2O2 — CID 56514556
tert-butyl N-[(1-cyclohex-2-en-1-ylpiperidin-3-yl)methyl]-N-propan-2-ylcarbamate (PubChem CID 56514556) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is tert-butyl N-[(1-cyclohex-2-en-1-ylpiperidin-3-yl)methyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[(1-cyclohex-2-en-1-ylpiperidin-3-yl)methyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 56514556 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | tert-butyl N-[(1-cyclohex-2-en-1-ylpiperidin-3-yl)methyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CC1CCCN(C2C=CCCC2)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36N2O2/c1-16(2)22(19(23)24-20(3,4)5)15-17-10-9-13-21(14-17)18-11-7-6-8-12-18/h7,11,16-18H,6,8-10,12-15H2,1-5H3 |
| InChIKey | CYHBMLCCWKMPHY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|