C24H29N3O3 — CID 56515351
N-[2-(2-ethylanilino)-2-oxoethyl]-N-methyl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56515351) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[2-(2-ethylanilino)-2-oxoethyl]-N-methyl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[2-(2-ethylanilino)-2-oxoethyl]-N-methyl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56515351 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[2-(2-ethylanilino)-2-oxoethyl]-N-methyl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C24H29N3O3/c1-3-18-11-7-8-14-20(18)25-21(28)17-26(2)24(30)23(19-12-5-4-6-13-19)27-16-10-9-15-22(27)29/h4-8,11-14,23H,3,9-10,15-17H2,1-2H3,(H,25,28) |
| InChIKey | TVNCEVDWWZJQPE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |