C21H22BrFN2O2 — CID 56577703
N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56577703) has the molecular formula C21H22BrFN2O2 and a molecular weight of 433.32 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56577703 |
| Molecular Formula | C21H22BrFN2O2 |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | CN(Cc1cc(Br)ccc1F)C(=O)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C21H22BrFN2O2/c1-24(14-16-13-17(22)10-11-18(16)23)21(27)20(15-7-3-2-4-8-15)25-12-6-5-9-19(25)26/h2-4,7-8,10-11,13,20H,5-6,9,12,14H2,1H3 |
| InChIKey | YMZWOQJZFWRPAM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |