C18H22BrN3O2S — CID 56516070
3-[[benzyl(methyl)carbamoyl]amino]-N-[(5-bromothiophen-2-yl)methyl]-N-methylpropanamide (PubChem CID 56516070) has the molecular formula C18H22BrN3O2S and a molecular weight of 424.36 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-[(5-bromothiophen-2-yl)methyl]-N-methylpropanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[(5-bromothiophen-2-yl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 56516070 |
| Molecular Formula | C18H22BrN3O2S |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[(5-bromothiophen-2-yl)methyl]-N-methylpropanamide |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)CCNC(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H22BrN3O2S/c1-21(13-15-8-9-16(19)25-15)17(23)10-11-20-18(24)22(2)12-14-6-4-3-5-7-14/h3-9H,10-13H2,1-2H3,(H,20,24) |
| InChIKey | JCUIEOFLMWOWPE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |