C22H27F2N3O2 — CID 56517196
4-(2,4-difluorophenoxy)-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]butanamide (PubChem CID 56517196) has the molecular formula C22H27F2N3O2 and a molecular weight of 403.47 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]butanamide.
| Compound Name | 4-(2,4-difluorophenoxy)-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 56517196 |
| Molecular Formula | C22H27F2N3O2 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]butanamide |
| SMILES | CN1CCN(c2ccccc2CNC(=O)CCCOc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C22H27F2N3O2/c1-26-10-12-27(13-11-26)20-6-3-2-5-17(20)16-25-22(28)7-4-14-29-21-9-8-18(23)15-19(21)24/h2-3,5-6,8-9,15H,4,7,10-14,16H2,1H3,(H,25,28) |
| InChIKey | YJCFNPWECBBQTK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|