C21H25ClFN3O2 — CID 60554347
N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-4-(2-fluorophenoxy)butanamide (PubChem CID 60554347) has the molecular formula C21H25ClFN3O2 and a molecular weight of 405.90 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-4-(2-fluorophenoxy)butanamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-4-(2-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 60554347 |
| Molecular Formula | C21H25ClFN3O2 |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-4-(2-fluorophenoxy)butanamide |
| SMILES | CN1CCN(c2ccc(Cl)cc2NC(=O)CCCOc2ccccc2F)CC1 |
| InChI | InChI=1S/C21H25ClFN3O2/c1-25-10-12-26(13-11-25)19-9-8-16(22)15-18(19)24-21(27)7-4-14-28-20-6-3-2-5-17(20)23/h2-3,5-6,8-9,15H,4,7,10-14H2,1H3,(H,24,27) |
| InChIKey | MXVZNKOWHZWHLX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|