C23H19F3N4O2 — CID 56520397
(Z)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N'-(2,3,4-trifluorophenyl)prop-2-enehydrazide (PubChem CID 56520397) has the molecular formula C23H19F3N4O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N'-(2,3,4-trifluorophenyl)prop-2-enehydrazide.
| Compound Name | (Z)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N'-(2,3,4-trifluorophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 56520397 |
| Molecular Formula | C23H19F3N4O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (Z)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N'-(2,3,4-trifluorophenyl)prop-2-enehydrazide |
| SMILES | COc1ccc(-n2c(C)cc(/C=C(/C#N)C(=O)NNc3ccc(F)c(F)c3F)c2C)cc1 |
| InChI | InChI=1S/C23H19F3N4O2/c1-13-10-15(14(2)30(13)17-4-6-18(32-3)7-5-17)11-16(12-27)23(31)29-28-20-9-8-19(24)21(25)22(20)26/h4-11,28H,1-3H3,(H,29,31)/b16-11- |
| InChIKey | OKRNBRJJCZJXHG-WJDWOHSUSA-N |
| XLogP | 4.57 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|