C20H24F2N4O3 — CID 56520922
5-cyano-N-(2,2-difluoroethyl)-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-(2-methoxyethyl)-4-oxopentanamide (PubChem CID 56520922) has the molecular formula C20H24F2N4O3 and a molecular weight of 406.43 g/mol. Its IUPAC name is 5-cyano-N-(2,2-difluoroethyl)-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-(2-methoxyethyl)-4-oxopentanamide.
| Compound Name | 5-cyano-N-(2,2-difluoroethyl)-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-(2-methoxyethyl)-4-oxopentanamide |
|---|---|
| PubChem CID | 56520922 |
| Molecular Formula | C20H24F2N4O3 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 5-cyano-N-(2,2-difluoroethyl)-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-(2-methoxyethyl)-4-oxopentanamide |
| SMILES | COCCN(CC(F)F)C(=O)CCC(=O)C(C#N)=C1N(C)c2ccccc2N1C |
| InChI | InChI=1S/C20H24F2N4O3/c1-24-15-6-4-5-7-16(15)25(2)20(24)14(12-23)17(27)8-9-19(28)26(10-11-29-3)13-18(21)22/h4-7,18H,8-11,13H2,1-3H3 |
| InChIKey | REBFSMXBEBRJPJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|