C22H26N6O2 — CID 56522069
3-methyl-N-[2-[4-methyl-3-(5-methyltetrazol-1-yl)anilino]-2-oxo-1-phenylethyl]butanamide (PubChem CID 56522069) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-methyl-N-[2-[4-methyl-3-(5-methyltetrazol-1-yl)anilino]-2-oxo-1-phenylethyl]butanamide.
| Compound Name | 3-methyl-N-[2-[4-methyl-3-(5-methyltetrazol-1-yl)anilino]-2-oxo-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 56522069 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 3-methyl-N-[2-[4-methyl-3-(5-methyltetrazol-1-yl)anilino]-2-oxo-1-phenylethyl]butanamide |
| SMILES | Cc1ccc(NC(=O)C(NC(=O)CC(C)C)c2ccccc2)cc1-n1nnnc1C |
| InChI | InChI=1S/C22H26N6O2/c1-14(2)12-20(29)24-21(17-8-6-5-7-9-17)22(30)23-18-11-10-15(3)19(13-18)28-16(4)25-26-27-28/h5-11,13-14,21H,12H2,1-4H3,(H,23,30)(H,24,29) |
| InChIKey | IUDBOJQUVNVGEC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |