C16H16FN7O — CID 95320054
1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[(1S)-1-pyridin-4-ylethyl]urea (PubChem CID 95320054) has the molecular formula C16H16FN7O and a molecular weight of 341.35 g/mol. Its IUPAC name is 1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[(1S)-1-pyridin-4-ylethyl]urea.
| Compound Name | 1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[(1S)-1-pyridin-4-ylethyl]urea |
|---|---|
| PubChem CID | 95320054 |
| Molecular Formula | C16H16FN7O |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[(1S)-1-pyridin-4-ylethyl]urea |
| SMILES | Cc1nnnn1-c1cc(NC(=O)N[C@@H](C)c2ccncc2)ccc1F |
| InChI | InChI=1S/C16H16FN7O/c1-10(12-5-7-18-8-6-12)19-16(25)20-13-3-4-14(17)15(9-13)24-11(2)21-22-23-24/h3-10H,1-2H3,(H2,19,20,25)/t10-/m0/s1 |
| InChIKey | KTZKGUARJGMRMX-JTQLQIEISA-N |
| XLogP | 2.39 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |