C17H16F2N6O2 — CID 166208770
1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[1-(4-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 166208770) has the molecular formula C17H16F2N6O2 and a molecular weight of 374.35 g/mol. Its IUPAC name is 1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[1-(4-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[1-(4-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 166208770 |
| Molecular Formula | C17H16F2N6O2 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[1-(4-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | Cc1nnnn1-c1cc(NC(=O)NC(CO)c2ccc(F)cc2)ccc1F |
| InChI | InChI=1S/C17H16F2N6O2/c1-10-22-23-24-25(10)16-8-13(6-7-14(16)19)20-17(27)21-15(9-26)11-2-4-12(18)5-3-11/h2-8,15,26H,9H2,1H3,(H2,20,21,27) |
| InChIKey | KOFUHOCVSFZHHW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |