C15H19FN6O2 — CID 95320049
1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea (PubChem CID 95320049) has the molecular formula C15H19FN6O2 and a molecular weight of 334.36 g/mol. Its IUPAC name is 1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 95320049 |
| Molecular Formula | C15H19FN6O2 |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea |
| SMILES | Cc1nnnn1-c1cc(NC(=O)N[C@@H](C)[C@H]2CCCO2)ccc1F |
| InChI | InChI=1S/C15H19FN6O2/c1-9(14-4-3-7-24-14)17-15(23)18-11-5-6-12(16)13(8-11)22-10(2)19-20-21-22/h5-6,8-9,14H,3-4,7H2,1-2H3,(H2,17,18,23)/t9-,14+/m0/s1 |
| InChIKey | LUMHZDFPPKJBLH-LKFCYVNXSA-N |
| XLogP | 1.80 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |