C17H22FN7O2 — CID 129344839
(4aR,8aS)-N-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine-6-carboxamide (PubChem CID 129344839) has the molecular formula C17H22FN7O2 and a molecular weight of 375.41 g/mol. Its IUPAC name is (4aR,8aS)-N-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aR,8aS)-N-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 129344839 |
| Molecular Formula | C17H22FN7O2 |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (4aR,8aS)-N-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine-6-carboxamide |
| SMILES | Cc1nnnn1-c1cc(NC(=O)N2CC[C@@H]3OCCN(C)[C@@H]3C2)ccc1F |
| InChI | InChI=1S/C17H22FN7O2/c1-11-20-21-22-25(11)14-9-12(3-4-13(14)18)19-17(26)24-6-5-16-15(10-24)23(2)7-8-27-16/h3-4,9,15-16H,5-8,10H2,1-2H3,(H,19,26)/t15-,16+/m1/s1 |
| InChIKey | HPDMUBAKJYQEHD-CVEARBPZSA-N |
| XLogP | 1.05 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |